EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O4 |
| Net Charge | 0 |
| Average Mass | 230.219 |
| Monoisotopic Mass | 230.05791 |
| SMILES | O=C(O)c1ccccc1-c1cccc(O)c1O |
| InChI | InChI=1S/C13H10O4/c14-11-7-3-6-9(12(11)15)8-4-1-2-5-10(8)13(16)17/h1-7,14-15H,(H,16,17) |
| InChIKey | ZEPICJFODWLEJX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Dihydroxy-2'-carboxybiphenyl (CHEBI:80406) is a biphenyls (CHEBI:22888) |
| 2,3-Dihydroxy-2'-carboxybiphenyl (CHEBI:80406) is a carboxybiphenyl (CHEBI:141493) |
| Manual Xrefs | Databases |
|---|---|
| C16263 | KEGG COMPOUND |