EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O3 |
| Net Charge | 0 |
| Average Mass | 214.220 |
| Monoisotopic Mass | 214.06299 |
| SMILES | O=C1c2ccccc2C2=CC=C[C@@H](O)[C@]12O |
| InChI | InChI=1S/C13H10O3/c14-11-7-3-6-10-8-4-1-2-5-9(8)12(15)13(10,11)16/h1-7,11,14,16H/t11-,13+/m1/s1 |
| InChIKey | CZWUUOGKBHOBEC-YPMHNXCESA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Hydro-1,1a-dihydroxy-9-fluorenone (CHEBI:80405) is a fluorenes (CHEBI:24059) |
| Manual Xrefs | Databases |
|---|---|
| C16262 | KEGG COMPOUND |