EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O4 |
| Net Charge | 0 |
| Average Mass | 272.300 |
| Monoisotopic Mass | 272.10486 |
| SMILES | COc1ccc([C@@H]2COc3cc(O)ccc3C2)c(O)c1 |
| InChI | InChI=1S/C16H16O4/c1-19-13-4-5-14(15(18)8-13)11-6-10-2-3-12(17)7-16(10)20-9-11/h2-5,7-8,11,17-18H,6,9H2,1H3/t11-/m0/s1 |
| InChIKey | XRVFNNUXNVWYTI-NSHDSACASA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-vestitol (CHEBI:80392) has parent hydride (R)-isoflavan (CHEBI:36101) |
| (−)-vestitol (CHEBI:80392) has role plant metabolite (CHEBI:76924) |
| (−)-vestitol (CHEBI:80392) is a hydroxyisoflavans (CHEBI:76250) |
| (−)-vestitol (CHEBI:80392) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| (3R)-3-(2-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-7-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6068457 | Reaxys |
| CAS:35878-41-2 | ChemIDplus |
| CAS:35878-41-2 | KEGG COMPOUND |