EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8028 - perphenazine
| Formula | C21H26ClN3OS |
| Net Charge | 0 |
| Average Mass | 403.979 |
| Monoisotopic Mass | 403.14851 |
| SMILES | OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2 |
| InChIKey | RGCVKNLCSQQDEP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perphenazine (CHEBI:8028) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| perphenazine (CHEBI:8028) has role antiemetic (CHEBI:50919) |
| perphenazine (CHEBI:8028) has role dopaminergic antagonist (CHEBI:48561) |
| perphenazine (CHEBI:8028) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| perphenazine (CHEBI:8028) is a N-(2-hydroxyethyl)piperazine (CHEBI:46851) |
| perphenazine (CHEBI:8028) is a N-alkylpiperazine (CHEBI:46845) |
| perphenazine (CHEBI:8028) is a organochlorine compound (CHEBI:36683) |
| perphenazine (CHEBI:8028) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| perphenazine maleate (CHEBI:34912) has part perphenazine (CHEBI:8028) |
| IUPAC Name |
|---|
| 2-{4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl}ethanol |
| INNs | Source |
|---|---|
| perphenazine | WHO MedNet |
| perphénazine | WHO MedNet |
| perphenazinum | WHO MedNet |
| perfenazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Perphenazine | KEGG COMPOUND |
| 2-chloro-10-(3-(4-(2-hydroxyethyl)piperazin-1-yl)propyl)phenothiazine | NIST Chemistry WebBook |
| 2-(4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]-1-piperazinyl)ethanol | NIST Chemistry WebBook |
| Trilafon | ChemIDplus |
| Chlorpiprazine | ChemIDplus |
| γ-(4-(β-hydroxyethyl)piperazin-1-yl)propyl-2-chlorophenothiazine | NIST Chemistry WebBook |
| Citations |
|---|