EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26ClN3OS |
| Net Charge | 0 |
| Average Mass | 403.979 |
| Monoisotopic Mass | 403.14851 |
| SMILES | OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2 |
| InChIKey | RGCVKNLCSQQDEP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perphenazine (CHEBI:8028) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| perphenazine (CHEBI:8028) has role antidepressant (CHEBI:35469) |
| perphenazine (CHEBI:8028) has role antiemetic (CHEBI:50919) |
| perphenazine (CHEBI:8028) has role antipsychotic agent (CHEBI:35476) |
| perphenazine (CHEBI:8028) has role anxiolytic drug (CHEBI:35474) |
| perphenazine (CHEBI:8028) has role dopaminergic antagonist (CHEBI:48561) |
| perphenazine (CHEBI:8028) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| perphenazine (CHEBI:8028) is a N-(2-hydroxyethyl)piperazine (CHEBI:46851) |
| perphenazine (CHEBI:8028) is a N-alkylpiperazine (CHEBI:46845) |
| perphenazine (CHEBI:8028) is a organochlorine compound (CHEBI:36683) |
| perphenazine (CHEBI:8028) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| perphenazine maleate (CHEBI:34912) has part perphenazine (CHEBI:8028) |
| IUPAC Name |
|---|
| 2-{4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl}ethanol |
| INNs | Source |
|---|---|
| perfenazina | WHO MedNet |
| perphenazine | WHO MedNet |
| perphénazine | WHO MedNet |
| perphenazinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]-1-piperazinyl)ethanol | NIST Chemistry WebBook |
| 2-chloro-10-(3-(4-(2-hydroxyethyl)piperazin-1-yl)propyl)phenothiazine | NIST Chemistry WebBook |
| 4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]-1-piperazineethanol | NIST Chemistry WebBook |
| 4-[3-(2-chlorophenothiazin-10-yl)propyl]-1-piperazineethanol | NIST Chemistry WebBook |
| Chlorpiprazine | ChemIDplus |
| NSC-150866 | ChEMBL |
| Brand Names | Source |
|---|---|
| Decentan | ChEMBL |
| Fentazin | ChEMBL |
| Perphenazine component of etrafon-a | ChEMBL |
| Trilafon-la | ChEMBL |
| Citations |
|---|