EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H29N4O8P2S |
| Net Charge | +1 |
| Average Mass | 511.454 |
| Monoisotopic Mass | 511.11758 |
| SMILES | CC[C@H](C)C(O)c1sc(CCOP(=O)(O)OP(=O)(O)O)c(C)[n+]1Cc1cnc(C)nc1N |
| InChI | InChI=1S/C17H28N4O8P2S/c1-5-10(2)15(22)17-21(9-13-8-19-12(4)20-16(13)18)11(3)14(32-17)6-7-28-31(26,27)29-30(23,24)25/h8,10,15,22H,5-7,9H2,1-4H3,(H4-,18,19,20,23,24,25,26,27)/p+1/t10-,15?/m0/s1 |
| InChIKey | CUBSXOWPMAOFDG-MYHCZTBNSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-1-hydroxybutyl-ThPP (CHEBI:80223) is a thiamine phosphate (CHEBI:26945) |
| Synonym | Source |
|---|---|
| 2-Methyl-1-hydroxybutyl-TPP | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15978 | KEGG COMPOUND |
| HMDB0012310 | HMDB |