EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H54O3 |
| Net Charge | 0 |
| Average Mass | 582.869 |
| Monoisotopic Mass | 582.40730 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)[C@@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H54O3/c1-28(17-13-19-30(3)21-23-35-32(5)25-34(41)26-39(35,7)8)15-11-12-16-29(2)18-14-20-31(4)22-24-36-33(6)38(43)37(42)27-40(36,9)10/h11-24,34,37,41-42H,25-27H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,28-15+,29-16+,30-19+,31-20+/t34-,37+/m1/s1 |
| InChIKey | YECXHLPYMXGEBI-ZNQVSPAOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agrobacterium aurantiacum (ncbitaxon:44155) | - | Article (Yokoyama, A., Izumida, H. and Miki, W. Production of Astaxanthin and 4-Ketozeaxanthin by the Marine Bacterium, Agro-bacterium aurantiacum (1994). Biosci. Biotech. Biochem. 58(10), p 1842-1844) | |
| Chlorosarcinopsis sp. (ncbitaxon:2077239) | - | PubMed (29439525) | Strain: PY02 |
| Nicotiana tabacum (ncbitaxon:4097) | leaf (BTO:0000713) | PubMed (15272869) | Isolated from transgenic plant |
| Rupicola peruviana (ncbitaxon:114383) | feather (BTO:0000447) | PubMed (22669477) | |
| Solanum lycopersicum (ncbitaxon:4081) | leaf (BTO:0000713) | PubMed (15272869) | Isolated from transgenic plant |
| Tetradesmus obliquus (ncbitaxon:3088) | cell suspension culture (BTO:0000221) | Article (Qin, S., Liu, G-X. and Hu, Z-Y. The accumulation and metabolism of astaxanthin in Scenedesmus obliquus (Chlorophyceae) (2008). Process Biochemistry, 43, p 795–802) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adonixanthin (CHEBI:80217) has role algal metabolite (CHEBI:84735) |
| adonixanthin (CHEBI:80217) has role animal metabolite (CHEBI:75767) |
| adonixanthin (CHEBI:80217) has role antineoplastic agent (CHEBI:35610) |
| adonixanthin (CHEBI:80217) has role bacterial metabolite (CHEBI:76969) |
| adonixanthin (CHEBI:80217) has role marine metabolite (CHEBI:76507) |
| adonixanthin (CHEBI:80217) has role plant metabolite (CHEBI:76924) |
| adonixanthin (CHEBI:80217) is a carotenone (CHEBI:35310) |
| adonixanthin (CHEBI:80217) is a cyclic ketone (CHEBI:3992) |
| adonixanthin (CHEBI:80217) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,3'R)-3,3'-dihydroxy-β,β-caroten-4-one |
| Synonyms | Source |
|---|---|
| (3S,3'R)-4-ketozeaxanthin | ChEBI |
| (3S,3'R)-adonixanthin | ChEBI |
| (3S,3'R)-dihydroxy-4-keto-β,β-carotene | MetaCyc |
| 4-Ketozeaxanthin | KEGG COMPOUND |
| adonixanthin | LIPID MAPS |
| doradexanthin | KNApSAcK |
| UniProt Name | Source |
|---|---|
| all-trans-adonixanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000917 | KNApSAcK |
| C15968 | KEGG COMPOUND |
| CPD-7852 | MetaCyc |
| LMPR01070016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6494355 | Reaxys |
| CAS:4418-73-9 | KNApSAcK |
| CAS:4418-73-9 | ChemIDplus |
| Citations |
|---|