EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2S.CH4O3S |
| Net Charge | 0 |
| Average Mass | 410.605 |
| Monoisotopic Mass | 410.16978 |
| SMILES | CS(=O)(=O)O.[H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C[C@@H](CSC)CN2CCC |
| InChI | InChI=1S/C19H26N2S.CH4O3S/c1-3-7-21-11-13(12-22-2)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21;1-5(2,3)4/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3;1H3,(H,2,3,4)/t13-,16-,18-;/m1./s1 |
| InChIKey | UWCVGPLTGZWHGS-ZORIOUSZSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pergolide mesylate (CHEBI:8021) has part pergolide(1+) (CHEBI:63706) |
| pergolide mesylate (CHEBI:8021) has role antiparkinson drug (CHEBI:48407) |
| pergolide mesylate (CHEBI:8021) has role dopamine agonist (CHEBI:51065) |
| pergolide mesylate (CHEBI:8021) has role geroprotector (CHEBI:176497) |
| pergolide mesylate (CHEBI:8021) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| (8β)-8-[(methylsulfanyl)methyl]-6-propylergoline methanesulfonate |
| Synonyms | Source |
|---|---|
| (8β)-8-[(methylsulfanyl)methyl]-6-propylergolin-6-ium methanesulfonate | IUPAC |
| Pergolide mesilate | KEGG DRUG |
| pergolide methanesulfonate | ChEBI |
| pergolide monomesylate | ChEBI |
| pergolide monomethanesulfonate | ChEBI |
| Brand Name | Source |
|---|---|
| Permax | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 43504 | ChemSpider |
| D00502 | KEGG DRUG |
| DBSALT002445 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5698117 | Reaxys |
| CAS:66104-23-2 | KEGG DRUG |
| CAS:66104-23-2 | ChemIDplus |
| Citations |
|---|