EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C69H111N23O16S |
| Net Charge | 0 |
| Average Mass | 1550.859 |
| Monoisotopic Mass | 1549.82999 |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C69H111N23O16S/c1-39(2)32-47(86-58(98)44(17-9-26-78-68(73)74)83-63(103)52-20-12-29-91(52)65(105)45(18-10-27-79-69(75)76)84-56(96)42(71)22-23-54(72)94)59(99)89-50(37-93)61(101)87-48(34-41-35-77-38-81-41)60(100)82-43(16-7-8-25-70)57(97)80-36-55(95)90-28-11-19-51(90)62(102)85-46(24-31-109-3)66(106)92-30-13-21-53(92)64(104)88-49(67(107)108)33-40-14-5-4-6-15-40/h4-6,14-15,35,38-39,42-53,93H,7-13,16-34,36-37,70-71H2,1-3H3,(H2,72,94)(H,77,81)(H,80,97)(H,82,100)(H,83,103)(H,84,96)(H,85,102)(H,86,98)(H,87,101)(H,88,104)(H,89,99)(H,107,108)(H4,73,74,78)(H4,75,76,79)/t42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-/m0/s1 |
| InChIKey | XXCCRHIAIBQDPX-PEWBXTNBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. biomarker A substance used as an indicator of a biological state. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apelin-13 (CHEBI:80131) has role antihypertensive agent (CHEBI:35674) |
| apelin-13 (CHEBI:80131) has role autophagy inhibitor (CHEBI:88230) |
| apelin-13 (CHEBI:80131) has role biomarker (CHEBI:59163) |
| apelin-13 (CHEBI:80131) has role human metabolite (CHEBI:77746) |
| apelin-13 (CHEBI:80131) has role neuroprotective agent (CHEBI:63726) |
| apelin-13 (CHEBI:80131) is a oligopeptide (CHEBI:25676) |
| apelin-13 (CHEBI:80131) is conjugate base of apelin-13(3+) (CHEBI:147395) |
| Incoming Relation(s) |
| apelin-13(3+) (CHEBI:147395) is conjugate acid of apelin-13 (CHEBI:80131) |
| IUPAC Name |
|---|
| L-glutaminyl-L-arginyl-L-prolyl-L-arginyl-L-leucyl-L-seryl-L-histidyl-L-lysylglycyl-L-prolyl-L-methionyl-L-prolyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| apelin 13 | ChEBI |
| apelin-13 peptide | HMDB |
| Gln-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro-Phe | ChEBI |
| Q-R-P-R-L-S-H-K-G-P-M-P-F | ChEBI |
| QRPRLSHKGPMPF | ChEBI |
| L-Gln-L-Arg-L-Pro-L-Arg-L-Leu-L-Ser-L-His-L-Lys-L-Gly-L-Pro-L-Met-L-Pro-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15855 | KEGG COMPOUND |
| FDB029200 | FooDB |
| HMDB0012894 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:217082-58-1 | ChemIDplus |
| Citations |
|---|