EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C69H111N23O16S |
| Net Charge | 0 |
| Average Mass | 1550.859 |
| Monoisotopic Mass | 1549.82999 |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C69H111N23O16S/c1-39(2)32-47(86-58(98)44(17-9-26-78-68(73)74)83-63(103)52-20-12-29-91(52)65(105)45(18-10-27-79-69(75)76)84-56(96)42(71)22-23-54(72)94)59(99)89-50(37-93)61(101)87-48(34-41-35-77-38-81-41)60(100)82-43(16-7-8-25-70)57(97)80-36-55(95)90-28-11-19-51(90)62(102)85-46(24-31-109-3)66(106)92-30-13-21-53(92)64(104)88-49(67(107)108)33-40-14-5-4-6-15-40/h4-6,14-15,35,38-39,42-53,93H,7-13,16-34,36-37,70-71H2,1-3H3,(H2,72,94)(H,77,81)(H,80,97)(H,82,100)(H,83,103)(H,84,96)(H,85,102)(H,86,98)(H,87,101)(H,88,104)(H,89,99)(H,107,108)(H4,73,74,78)(H4,75,76,79)/t42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-/m0/s1 |
| InChIKey | XXCCRHIAIBQDPX-PEWBXTNBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | biomarker A substance used as an indicator of a biological state. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apelin-13 (CHEBI:80131) has role antihypertensive agent (CHEBI:35674) |
| apelin-13 (CHEBI:80131) has role autophagy inhibitor (CHEBI:88230) |
| apelin-13 (CHEBI:80131) has role biomarker (CHEBI:59163) |
| apelin-13 (CHEBI:80131) has role human metabolite (CHEBI:77746) |
| apelin-13 (CHEBI:80131) has role neuroprotective agent (CHEBI:63726) |
| apelin-13 (CHEBI:80131) is a oligopeptide (CHEBI:25676) |
| apelin-13 (CHEBI:80131) is conjugate base of apelin-13(3+) (CHEBI:147395) |
| Incoming Relation(s) |
| apelin-13(3+) (CHEBI:147395) is conjugate acid of apelin-13 (CHEBI:80131) |
| IUPAC Name |
|---|
| L-glutaminyl-L-arginyl-L-prolyl-L-arginyl-L-leucyl-L-seryl-L-histidyl-L-lysylglycyl-L-prolyl-L-methionyl-L-prolyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| apelin 13 | ChEBI |
| apelin-13 peptide | HMDB |
| Gln-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro-Phe | ChEBI |
| Q-R-P-R-L-S-H-K-G-P-M-P-F | ChEBI |
| QRPRLSHKGPMPF | ChEBI |
| L-Gln-L-Arg-L-Pro-L-Arg-L-Leu-L-Ser-L-His-L-Lys-L-Gly-L-Pro-L-Met-L-Pro-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15855 | KEGG COMPOUND |
| FDB029200 | FooDB |
| HMDB0012894 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:217082-58-1 | ChemIDplus |
| Citations |
|---|