EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H78N16O13 |
| Net Charge | 0 |
| Average Mass | 1183.339 |
| Monoisotopic Mass | 1182.59343 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(=O)N[C@@H](Cc1cncn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C56H78N16O13/c1-5-31(4)46(71-50(79)40(22-33-15-17-36(73)18-16-33)67-52(81)45(30(2)3)70-48(77)38(13-9-19-62-56(58)59)65-47(76)37(57)25-44(74)75)53(82)68-41(23-34-26-60-28-63-34)54(83)72-20-10-14-43(72)51(80)66-39(21-32-11-7-6-8-12-32)49(78)69-42(55(84)85)24-35-27-61-29-64-35/h6-8,11-12,15-18,26-31,37-43,45-46,73H,5,9-10,13-14,19-25,57H2,1-4H3,(H,60,63)(H,61,64)(H,65,76)(H,66,80)(H,67,81)(H,68,82)(H,69,78)(H,70,77)(H,71,79)(H,74,75)(H,84,85)(H4,58,59,62)/t31-,37-,38-,39-,40-,41-,42-,43-,45-,46-/m0/s1 |
| InChIKey | LJXGOQOPNPFXFT-JWRYNVNRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO_0000131) | PubMed (2170511) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (26988149) | Identified in the renal arteries isolated from Wistar Kyoto rats. |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| angiotensin (1-9) (CHEBI:80128) has role antihypertensive agent (CHEBI:35674) |
| angiotensin (1-9) (CHEBI:80128) has role cardioprotective agent (CHEBI:77307) |
| angiotensin (1-9) (CHEBI:80128) has role human metabolite (CHEBI:77746) |
| angiotensin (1-9) (CHEBI:80128) has role rat metabolite (CHEBI:86264) |
| angiotensin (1-9) (CHEBI:80128) is a angiotensin (CHEBI:48433) |
| angiotensin (1-9) (CHEBI:80128) is tautomer of angiotensin (1-9) dizwitterion (CHEBI:147351) |
| Incoming Relation(s) |
| angiotensin (1-9) dizwitterion (CHEBI:147351) is tautomer of angiotensin (1-9) (CHEBI:80128) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-arginyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanyl-L-histidine |
| Synonyms | Source |
|---|---|
| ang-(1-9) | ChEBI |
| angiotensin-(1-9) | ChEBI |
| angiotensin I (1-9) | ChEBI |
| Asp-Arg-Val-Tyr-Ile-His-Pro-Phe-His | ChEBI |
| des-Leu angiotensin I | ChEBI |
| [des-Leu10]-angiotensin I | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15851 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:34273-12-6 | ChEBI |
| Citations |
|---|