EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O3 |
| Net Charge | 0 |
| Average Mass | 352.434 |
| Monoisotopic Mass | 352.17869 |
| SMILES | [H][C@@]12C[C@]3([H])C(C(=O)OC)=CO[C@H](C)[C@@]3([H])CN1CCc1c2nc2ccccc12 |
| InChI | InChI=1S/C21H24N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-6,11-12,15-16,19,22H,7-10H2,1-2H3/t12-,15+,16-,19+/m1/s1 |
| InChIKey | GRTOGORTSDXSFK-XIEZEKGWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-epi-Ajmalicine (CHEBI:801) is a methyl ester (CHEBI:25248) |
| 19-epi-Ajmalicine (CHEBI:801) is a yohimban alkaloid (CHEBI:27358) |
| Synonym | Source |
|---|---|
| 19-epi-Ajmalicine | KEGG COMPOUND |