EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H51N7O7 |
| Net Charge | 0 |
| Average Mass | 621.780 |
| Monoisotopic Mass | 621.38500 |
| SMILES | CC(C)CCCCCCCCCCCCC(=O)NCC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](Nc2ncnc3ncnc23)O[C@H]1C(O)CO |
| InChI | InChI=1S/C30H51N7O7/c1-19(2)13-11-9-7-5-3-4-6-8-10-12-14-21(40)31-15-22(41)36-23-25(42)26(43)30(44-27(23)20(39)16-38)37-29-24-28(33-17-32-24)34-18-35-29/h17-20,23,25-27,30,38-39,42-43H,3-16H2,1-2H3,(H,31,40)(H,36,41)(H2,32,33,34,35,37)/t20?,23-,25-,26+,27+,30+/m1/s1 |
| InChIKey | YBZRLMLGUBIIDN-CGWIKHJNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Septacidin (CHEBI:80082) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| C15754 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:62362-59-8 | KEGG COMPOUND |