EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H70O11 |
| Net Charge | 0 |
| Average Mass | 751.011 |
| Monoisotopic Mass | 750.49181 |
| SMILES | [H][C@]1([C@@H](CC)C(=O)[C@@H](C)[C@@H](O)[C@H](C)[C@]2([H])O[C@@]([H])([C@@H](CC)C(=O)O)CC[C@@H]2C)O[C@]2(C=C[C@@H](O)[C@]3(CC[C@@](C)([C@@]4([H])CC[C@](O)(CC)[C@H](C)O4)O3)O2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C42H70O11/c1-11-29(38(46)47)31-15-14-23(4)36(50-31)27(8)34(44)26(7)35(45)30(12-2)37-24(5)22-25(6)41(51-37)19-16-32(43)42(53-41)21-20-39(10,52-42)33-17-18-40(48,13-3)28(9)49-33/h16,19,23-34,36-37,43-44,48H,11-15,17-18,20-22H2,1-10H3,(H,46,47)/t23-,24-,25+,26-,27-,28-,29+,30-,31+,32+,33+,34+,36+,37-,39-,40+,41-,42-/m0/s1 |
| InChIKey | KQXDHUJYNAXLNZ-XQSDOZFQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | potassium ionophore Any ionophore capable of transportation of potassium ions across membranes. |
| Application: | animal growth promotant Substances that are administered to farmed animals to improve productivity by promoting weight gain, increasing muscle mass, limiting fat deposition, reducing feed consumption, and reducing waste production. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salinomycin (CHEBI:80025) has role animal growth promotant (CHEBI:82655) |
| Salinomycin (CHEBI:80025) has role potassium ionophore (CHEBI:88227) |
| Salinomycin (CHEBI:80025) is a polyketide (CHEBI:26188) |
| Salinomycin (CHEBI:80025) is a spiroketal (CHEBI:72600) |
| Manual Xrefs | Databases |
|---|---|
| C00018019 | KNApSAcK |
| D08502 | KEGG DRUG |
| C15690 | KEGG COMPOUND |
| Salinomycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:53003-10-4 | KEGG COMPOUND |