EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NO6 |
| Net Charge | 0 |
| Average Mass | 397.427 |
| Monoisotopic Mass | 397.15254 |
| SMILES | [H][C@]1(c2oc(OC)c(C)c(=O)c2C)C/C(=C/C(C)=C/c2ccc([N+](=O)[O-])cc2)CO1 |
| InChI | InChI=1S/C22H23NO6/c1-13(9-16-5-7-18(8-6-16)23(25)26)10-17-11-19(28-12-17)21-14(2)20(24)15(3)22(27-4)29-21/h5-10,19H,11-12H2,1-4H3/b13-9+,17-10-/t19-/m1/s1 |
| InChIKey | GQKXCBCSVYJUMI-WACKOAQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces thioluteus (ncbitaxon:66431) | cell suspension culture (BTO:0000221) | Article (Hirata, Y., Nakata, H., Yamada, K., Okuhara, K. and Naito, T. (1961) The structure of aureothin, a nitro compound obtained from Streptomyces thioluteus. Tetrahedron, 14(3), 252-274.) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 1.6.5.3 [NADH:ubiquinone reductase (H(+)-translocating)] inhibitor A respiratory-chain inhibitor that interferes with the action of the the enzyme NADH:ubiquinone reductase (H+-translocating), EC 1.6.5.3. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aureothin (CHEBI:80024) has functional parent deoxyaureothin (CHEBI:142840) |
| aureothin (CHEBI:80024) has role antibacterial agent (CHEBI:33282) |
| aureothin (CHEBI:80024) has role antifungal agent (CHEBI:35718) |
| aureothin (CHEBI:80024) has role antineoplastic agent (CHEBI:35610) |
| aureothin (CHEBI:80024) has role antiparasitic agent (CHEBI:35442) |
| aureothin (CHEBI:80024) has role bacterial metabolite (CHEBI:76969) |
| aureothin (CHEBI:80024) has role EC 1.6.5.3 [NADH:ubiquinone reductase (H+-translocating)] inhibitor (CHEBI:38503) |
| aureothin (CHEBI:80024) is a C-nitro compound (CHEBI:35716) |
| aureothin (CHEBI:80024) is a 4-pyranones (CHEBI:131906) |
| aureothin (CHEBI:80024) is a ketene acetal (CHEBI:145408) |
| aureothin (CHEBI:80024) is a olefinic compound (CHEBI:78840) |
| aureothin (CHEBI:80024) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| 2-methoxy-3,5-dimethyl-6-{(2R,4Z)-4-[(2E)-2-methyl-3-(4-nitrophenyl)prop-2-en-1-ylidene]tetrahydrofuran-2-yl}-4H-pyran-4-one |
| Synonyms | Source |
|---|---|
| 2-methoxy-3,5-dimethyl-6-[(2R,5Z)-5-[(E)-2-methyl-3-(4-nitrophenyl)prop-2-enylidene]oxolan-2-yl]pyran-4-one | ChEBI |
| (+)-aureothin | ChEBI |
| UniProt Name | Source |
|---|---|
| aureothin | UniProt |
| Citations |
|---|