EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NO6 |
| Net Charge | 0 |
| Average Mass | 397.427 |
| Monoisotopic Mass | 397.15254 |
| SMILES | [H][C@]1(c2oc(OC)c(C)c(=O)c2C)C/C(=C/C(C)=C/c2ccc([N+](=O)[O-])cc2)CO1 |
| InChI | InChI=1S/C22H23NO6/c1-13(9-16-5-7-18(8-6-16)23(25)26)10-17-11-19(28-12-17)21-14(2)20(24)15(3)22(27-4)29-21/h5-10,19H,11-12H2,1-4H3/b13-9+,17-10-/t19-/m1/s1 |
| InChIKey | GQKXCBCSVYJUMI-WACKOAQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces thioluteus (ncbitaxon:66431) | cell suspension culture (BTO:0000221) | Article (Hirata, Y., Nakata, H., Yamada, K., Okuhara, K. and Naito, T. (1961) The structure of aureothin, a nitro compound obtained from Streptomyces thioluteus. Tetrahedron, 14(3), 252-274.) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.6.5.3 [NADH:ubiquinone reductase (H(+)-translocating)] inhibitor A respiratory-chain inhibitor that interferes with the action of the the enzyme NADH:ubiquinone reductase (H+-translocating), EC 1.6.5.3. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aureothin (CHEBI:80024) has functional parent deoxyaureothin (CHEBI:142840) |
| aureothin (CHEBI:80024) has role antibacterial agent (CHEBI:33282) |
| aureothin (CHEBI:80024) has role antifungal agent (CHEBI:35718) |
| aureothin (CHEBI:80024) has role antineoplastic agent (CHEBI:35610) |
| aureothin (CHEBI:80024) has role antiparasitic agent (CHEBI:35442) |
| aureothin (CHEBI:80024) has role bacterial metabolite (CHEBI:76969) |
| aureothin (CHEBI:80024) has role EC 1.6.5.3 [NADH:ubiquinone reductase (H+-translocating)] inhibitor (CHEBI:38503) |
| aureothin (CHEBI:80024) is a C-nitro compound (CHEBI:35716) |
| aureothin (CHEBI:80024) is a 4-pyranones (CHEBI:131906) |
| aureothin (CHEBI:80024) is a ketene acetal (CHEBI:145408) |
| aureothin (CHEBI:80024) is a olefinic compound (CHEBI:78840) |
| aureothin (CHEBI:80024) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| 2-methoxy-3,5-dimethyl-6-{(2R,4Z)-4-[(2E)-2-methyl-3-(4-nitrophenyl)prop-2-en-1-ylidene]tetrahydrofuran-2-yl}-4H-pyran-4-one |
| Synonyms | Source |
|---|---|
| 2-methoxy-3,5-dimethyl-6-[(2R,5Z)-5-[(E)-2-methyl-3-(4-nitrophenyl)prop-2-enylidene]oxolan-2-yl]pyran-4-one | ChEBI |
| (+)-aureothin | ChEBI |
| UniProt Name | Source |
|---|---|
| aureothin | UniProt |
| Citations |
|---|