EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O |
| Net Charge | 0 |
| Average Mass | 276.464 |
| Monoisotopic Mass | 276.24532 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)CCC[C@]43[H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H32O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h13-17,20H,3-12H2,1-2H3/t13-,14+,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | DJTOLSNIKJIDFF-PHFHYRSDSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5alpha-Androstan-3alpha-ol (CHEBI:79998) has role androgen (CHEBI:50113) |
| 5alpha-Androstan-3alpha-ol (CHEBI:79998) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 3-Androstanol | KEGG COMPOUND |
| Androstanol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15638 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:7657-50-3 | KEGG COMPOUND |