EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H36F3N3O5 |
| Net Charge | 0 |
| Average Mass | 635.683 |
| Monoisotopic Mass | 635.26071 |
| SMILES | CCOC(=O)NC[C@H](Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)N/C(C)=C\C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H36F3N3O5/c1-4-44-34(43)39-22-29(40-23(2)20-32(42)26-12-14-28(15-13-26)35(36,37)38)21-25-10-16-30(17-11-25)45-19-18-31-24(3)46-33(41-31)27-8-6-5-7-9-27/h5-17,20,29,40H,4,18-19,21-22H2,1-3H3,(H,39,43)/b23-20-/t29-/m0/s1 |
| InChIKey | UEPVEQWUZJXOKB-DYQICHDWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW 6471 (CHEBI:79989) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| C15620 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:436159-64-7 | KEGG COMPOUND |