EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N |
| Net Charge | 0 |
| Average Mass | 173.259 |
| Monoisotopic Mass | 173.12045 |
| SMILES | C#CCN[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C12H15N/c1-3-9-13-11(2)10-12-7-5-4-6-8-12/h1,4-8,11,13H,9-10H2,2H3/t11-/m1/s1 |
| InChIKey | UUFAJPMQSFXDFR-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Norselegiline (CHEBI:79968) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| C15476 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:56862-28-3 | KEGG COMPOUND |