EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O6 |
| Net Charge | 0 |
| Average Mass | 366.454 |
| Monoisotopic Mass | 366.20424 |
| SMILES | CCCCOCCOC(=O)c1ccccc1C(=O)OCCOCCCC |
| InChI | InChI=1S/C20H30O6/c1-3-5-11-23-13-15-25-19(21)17-9-7-8-10-18(17)20(22)26-16-14-24-12-6-4-2/h7-10H,3-6,11-16H2,1-2H3 |
| InChIKey | CMCJNODIWQEOAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(2-butoxyethyl)phthalate (CHEBI:79937) has functional parent 2-butoxyethanol (CHEBI:63921) |
| bis(2-butoxyethyl)phthalate (CHEBI:79937) has role xenobiotic (CHEBI:35703) |
| bis(2-butoxyethyl)phthalate (CHEBI:79937) is a diester (CHEBI:51307) |
| bis(2-butoxyethyl)phthalate (CHEBI:79937) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| bis(2-butoxyethyl) benzene-1,2-dicarboxylate |
| Synonym | Source |
|---|---|
| beta-Butoxyethyl phthalate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15438 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2006754 | Reaxys |
| CAS:117-83-9 | KEGG COMPOUND |