EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27ClO3 |
| Net Charge | 0 |
| Average Mass | 350.886 |
| Monoisotopic Mass | 350.16487 |
| SMILES | [H][C@@]12CC[C@](C)(O)[C@@]1(C)CC(=O)[C@@]1(Cl)[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C20H27ClO3/c1-17-8-6-13(22)10-12(17)4-5-15-14-7-9-19(3,24)18(14,2)11-16(23)20(15,17)21/h10,14-15,24H,4-9,11H2,1-3H3/t14-,15-,17-,18-,19-,20-/m0/s1 |
| InChIKey | XRYZUTZZFFLDKN-MWTXUKJESA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Chloro-17beta-hydroxy-17-methylandrost-4-ene-3,11-dione (CHEBI:79908) has role androgen (CHEBI:50113) |
| 9-Chloro-17beta-hydroxy-17-methylandrost-4-ene-3,11-dione (CHEBI:79908) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15407 | KEGG COMPOUND |