EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O3 |
| Net Charge | 0 |
| Average Mass | 300.398 |
| Monoisotopic Mass | 300.17254 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC(=O)[C@]3([H])[C@@]1(C)C=CC(=O)C2 |
| InChI | InChI=1S/C19H24O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h7-8,11,13-14,17H,3-6,9-10H2,1-2H3/t11-,13-,14-,17+,18-,19-/m0/s1 |
| InChIKey | NYLSQMMWVJMFFO-XNTXBEAUSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5alpha-Androst-1-ene-3,11,17-trione (CHEBI:79907) has role androgen (CHEBI:50113) |
| 5alpha-Androst-1-ene-3,11,17-trione (CHEBI:79907) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15406 | KEGG COMPOUND |