EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O3 |
| Net Charge | 0 |
| Average Mass | 332.484 |
| Monoisotopic Mass | 332.23514 |
| SMILES | [H][C@@]12CC[C@](C)(O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=C(C)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H32O3/c1-12-14-6-5-13-15-7-10-21(4,24)20(15,3)11-17(23)18(13)19(14,2)9-8-16(12)22/h13,15,17-18,23-24H,5-11H2,1-4H3/t13-,15-,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | WGWIOQHCYQKREK-HWNNUFKUSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11beta,17beta-Dihydroxy-4,17-dimethylandrost-4-en-3-one (CHEBI:79902) has role androgen (CHEBI:50113) |
| 11beta,17beta-Dihydroxy-4,17-dimethylandrost-4-en-3-one (CHEBI:79902) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 11beta-Hydroxy-4,17-dimethyltestosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15401 | KEGG COMPOUND |