EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H63N5O9 |
| Net Charge | 0 |
| Average Mass | 685.904 |
| Monoisotopic Mass | 685.46258 |
| SMILES | CC(C)CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C34H63N5O9/c1-17(2)12-23(37-33(47)31(21(9)10)39-34(48)30(20(7)8)38-27(42)14-19(5)6)25(40)15-28(43)35-22(11)32(46)36-24(13-18(3)4)26(41)16-29(44)45/h17-26,30-31,40-41H,12-16H2,1-11H3,(H,35,43)(H,36,46)(H,37,47)(H,38,42)(H,39,48)(H,44,45)/t22-,23-,24-,25-,26-,30-,31-/m0/s1 |
| InChIKey | FAXGPCHRFPCXOO-LXTPJMTPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces testaceus (ncbitaxon:1883) | - | DOI (10.7164/antibiotics.23.259) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.4.23.* (aspartic endopeptidase) inhibitor An EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes with the action of any aspartic endopeptidase (EC 3.4.23.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pepstatin A (CHEBI:7989) has role bacterial metabolite (CHEBI:76969) |
| pepstatin A (CHEBI:7989) has role EC 3.4.23.* (aspartic endopeptidase) inhibitor (CHEBI:76885) |
| pepstatin A (CHEBI:7989) is a pentapeptide (CHEBI:48545) |
| pepstatin A (CHEBI:7989) is a secondary carboxamide (CHEBI:140325) |
| pepstatin A (CHEBI:7989) is conjugate acid of pepstatin A(1−) (CHEBI:190525) |
| Incoming Relation(s) |
| pepstatin A(1−) (CHEBI:190525) is conjugate base of pepstatin A (CHEBI:7989) |
| IUPAC Name |
|---|
| N-(3-methylbutanoyl)-L-valyl-N-[(3S,4S)-1-{[(2S)-1-{[(2S,3S)-1-carboxy-2-hydroxy-5-methylhexan-3-yl]amino}-1-oxopropan-2-yl]amino}-3-hydroxy-6-methyl-1-oxoheptan-4-yl]-L-valinamide |
| INNs | Source |
|---|---|
| pepstatin | WHO MedNet |
| pepstatine | WHO MedNet |
| pepstatina | WHO MedNet |
| pepstatinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (3S,4S)-3-hydroxy-4-[(2S)-2-[(3S,4S)-3-hydroxy-6-methyl-4-[(2S)-3-methyl-2-[(2S)-3-methyl-2-(3-methylbutanamido)butanamido]butanamido]heptanamido]propanamido]-6-methylheptanoic acid | IUPAC |
| ahpatinin C | ChemIDplus |
| pepsin inhibitor S 735A | ChemIDplus |
| procidin S 735A | ChemIDplus |
| Citations |
|---|