EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | [H][C@@]12C=CC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| InChI | InChI=1S/C20H28O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h4-5,12,15-17,22H,6-11H2,1-3H3/t15-,16+,17+,18+,19+,20+/m1/s1 |
| InChIKey | BRQAXEKVGOTNJM-HLXURNFRSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17alpha-Methyl-17beta-hydroxyandrosta-4,6-dien-3-one (CHEBI:79855) has role androgen (CHEBI:50113) |
| 17alpha-Methyl-17beta-hydroxyandrosta-4,6-dien-3-one (CHEBI:79855) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 17alpha-Methyl-6,7-dehydrotestosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15353 | KEGG COMPOUND |