EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26Br2O2 |
| Net Charge | 0 |
| Average Mass | 458.234 |
| Monoisotopic Mass | 456.02995 |
| SMILES | [H][C@@]12CC(=C(Br)Br)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C20H26Br2O2/c1-19-7-5-11(23)9-16(19)13(18(21)22)10-12-14-3-4-17(24)20(14,2)8-6-15(12)19/h9,12,14-15,17,24H,3-8,10H2,1-2H3/t12-,14-,15-,17-,19+,20-/m0/s1 |
| InChIKey | XDDMZNADWGQPRQ-CERPAYOZSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(Dibromomethylene)-17beta-hydroxyandrost-4-en-3-one (CHEBI:79854) has role androgen (CHEBI:50113) |
| 6-(Dibromomethylene)-17beta-hydroxyandrost-4-en-3-one (CHEBI:79854) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 6-(Dibromomethylene)testosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15352 | KEGG COMPOUND |