EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O2 |
| Net Charge | 0 |
| Average Mass | 314.469 |
| Monoisotopic Mass | 314.22458 |
| SMILES | [H][C@@]12CC[C@](C)(O)[C@@]1(C)CC=C1[C@@]3(C)C[C@@H](C)C(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C21H30O2/c1-13-12-19(2)14(11-18(13)22)5-6-15-16(19)7-9-20(3)17(15)8-10-21(20,4)23/h7,11,13,15,17,23H,5-6,8-10,12H2,1-4H3/t13-,15-,17+,19+,20+,21+/m1/s1 |
| InChIKey | WUWUSCYXVYUKNZ-PDFVNURISA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-Hydroxy-2alpha,17-dimethyl-4,9(11)-androstadien-3-one (CHEBI:79844) has role androgen (CHEBI:50113) |
| 17beta-Hydroxy-2alpha,17-dimethyl-4,9(11)-androstadien-3-one (CHEBI:79844) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 9(11)-Dehydro-2alpha,17-dimethyltestosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15342 | KEGG COMPOUND |