EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27NO |
| Net Charge | 0 |
| Average Mass | 285.431 |
| Monoisotopic Mass | 285.20926 |
| SMILES | CC(C)=CCN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2C |
| InChI | InChI=1S/C19H27NO/c1-13(2)7-9-20-10-8-19(4)14(3)18(20)11-15-5-6-16(21)12-17(15)19/h5-7,12,14,18,21H,8-11H2,1-4H3/t14-,18+,19+/m0/s1 |
| InChIKey | VOKSWYLNZZRQPF-GDIGMMSISA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentazocine (CHEBI:7982) has role analgesic (CHEBI:35480) |
| pentazocine (CHEBI:7982) has role antipsychotic agent (CHEBI:35476) |
| pentazocine (CHEBI:7982) is a benzazocine (CHEBI:39307) |
| INN | Source |
|---|---|
| pentazocina | WHO MedNet |
| Synonyms | Source |
|---|---|
| cis-(+/-)-Pentazocine | DrugCentral |
| dl-Pentazocine | DrugCentral |
| NIH-7958 | ChEMBL |
| NSC-107430 | ChEMBL |
| pentazocin | DrugCentral |
| Pentazocine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3424 | DrugCentral |
| C07421 | KEGG COMPOUND |
| D00498 | KEGG DRUG |
| HMDB0014790 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:359-83-1 | KEGG COMPOUND |
| Citations |
|---|