EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])[C@H](C)CC1=CC(=O)C=C[C@@]12C |
| InChI | InChI=1S/C20H28O2/c1-12-10-13-11-14(21)6-8-19(13,2)16-7-9-20(3)15(18(12)16)4-5-17(20)22/h6,8,11-12,15-18,22H,4-5,7,9-10H2,1-3H3/t12-,15+,16+,17+,18+,19+,20+/m1/s1 |
| InChIKey | YQVYJAMTSLBOFT-UQYBFTDGSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-Hydroxy-7alpha-methylandrost-1,4-diene-3-one (CHEBI:79809) has role androgen (CHEBI:50113) |
| 17beta-Hydroxy-7alpha-methylandrost-1,4-diene-3-one (CHEBI:79809) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 1-Dehydro-7alpha-methyltestosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15307 | KEGG COMPOUND |