EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@@H](O)C[C@]1(C)/C(=C\CO)CC[C@@]21[H] |
| InChI | InChI=1S/C21H28O3/c1-20-9-7-15(23)11-14(20)3-5-16-17-6-4-13(8-10-22)21(17,2)12-18(24)19(16)20/h7-9,11,16-19,22,24H,3-6,10,12H2,1-2H3/b13-8-/t16-,17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | FIMYJWIQTVIDQB-PKJGFKEFSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-11beta,21-Dihydroxypregna-1,4,17(20)-trien-3-one (CHEBI:79805) has role androgen (CHEBI:50113) |
| (Z)-11beta,21-Dihydroxypregna-1,4,17(20)-trien-3-one (CHEBI:79805) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15303 | KEGG COMPOUND |