EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 302.157 |
| Monoisotopic Mass | 301.02725 |
| SMILES | CC1(C(=O)O)CC1(C)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO3/c1-12(6-13(12,2)11(18)19)10(17)16-9-4-7(14)3-8(15)5-9/h3-5H,6H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | KIHJEJVWUXTXPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3,5-dichlorophenylcarbamoyl)-1,2-dimethylcyclopropane-1-carboxylic acid (CHEBI:79751) has functional parent cyclopropanecarboxylic acid (CHEBI:23500) |
| 2-(3,5-dichlorophenylcarbamoyl)-1,2-dimethylcyclopropane-1-carboxylic acid (CHEBI:79751) is a anilide (CHEBI:13248) |
| 2-(3,5-dichlorophenylcarbamoyl)-1,2-dimethylcyclopropane-1-carboxylic acid (CHEBI:79751) is a cyclopropanes (CHEBI:51454) |
| 2-(3,5-dichlorophenylcarbamoyl)-1,2-dimethylcyclopropane-1-carboxylic acid (CHEBI:79751) is a dichlorobenzene (CHEBI:23697) |
| 2-(3,5-dichlorophenylcarbamoyl)-1,2-dimethylcyclopropane-1-carboxylic acid (CHEBI:79751) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[(3,5-dichlorophenyl)carbamoyl]-1,2-dimethylcyclopropanecarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C15249 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8394814 | Reaxys |
| CAS:71937-45-6 | KEGG COMPOUND |
| CAS:71937-45-6 | ChemIDplus |