EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21O3PS |
| Net Charge | 0 |
| Average Mass | 288.349 |
| Monoisotopic Mass | 288.09490 |
| SMILES | CC(C)OP(=O)(OC(C)C)SCc1ccccc1 |
| InChI | InChI=1S/C13H21O3PS/c1-11(2)15-17(14,16-12(3)4)18-10-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3 |
| InChIKey | FCOAHACKGGIURQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | phospholipid biosynthesis inhibitor Any compound that inhibits the biosynthesis of any phospholipid. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iprobenfos (CHEBI:79737) has role antifungal agrochemical (CHEBI:86328) |
| iprobenfos (CHEBI:79737) has role phospholipid biosynthesis inhibitor (CHEBI:83741) |
| iprobenfos (CHEBI:79737) is a organic thiophosphate (CHEBI:37512) |
| IUPAC Name |
|---|
| S-benzyl O,O-dipropan-2-yl phosphorothioate |
| Synonyms | Source |
|---|---|
| Kitazin P | KEGG COMPOUND |
| O,O-Bis(1-methylethyl) S-(phenylmethyl)phosphorothioate | HMDB |
| O,O-Diisopropyl S-benzyl phosphorothioate | HMDB |
| O,O-DIIsopropyl S-benzyl thiophosphate | HMDB |
| Phosphorothioic acid, S-benzyl O,O-diisopropyl ester | NIST Chemistry WebBook |
| S-Benzyl diisopropyl phosphorothioate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1207 | PPDB |
| C15230 | KEGG COMPOUND |
| CN101569313 | Patent |
| CN101647467 | Patent |
| CN1930986 | Patent |
| HMDB0031768 | HMDB |
| iprobenfos | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1974687 | Reaxys |
| CAS:26087-47-8 | KEGG COMPOUND |
| CAS:26087-47-8 | ChemIDplus |
| CAS:26087-47-8 | NIST Chemistry WebBook |
| Citations |
|---|