EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2S4Zn |
| Net Charge | 0 |
| Average Mass | 305.834 |
| Monoisotopic Mass | 303.91747 |
| SMILES | CN(C)C(=S)[S][Zn][S]C(=S)N(C)C |
| InChI | InChI=1S/2C3H7NS2.Zn/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | DUBNHZYBDBBJHD-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ziram (CHEBI:79736) has functional parent dimethyldithiocarbamic acid (CHEBI:83061) |
| ziram (CHEBI:79736) has part dimethyldithiocarbamate (CHEBI:84293) |
| ziram (CHEBI:79736) has part zinc(2+) (CHEBI:29105) |
| ziram (CHEBI:79736) has role antifungal agrochemical (CHEBI:86328) |
| ziram (CHEBI:79736) has role apoptosis inducer (CHEBI:68495) |
| ziram (CHEBI:79736) is a dithiocarbamate salt (CHEBI:83060) |
| ziram (CHEBI:79736) is a zinc molecular entity (CHEBI:27364) |
| IUPAC Name |
|---|
| zinc bis(dimethylcarbamodithioate) |
| Synonyms | Source |
|---|---|
| bis(dimethylcarbamodithioato-S,S')zinc | ChemIDplus |
| bis-dimethyldithiocarbamate de zinc | ChemIDplus |
| bis(dimethyldithiocarbamato)zinc | ChemIDplus |
| dimethyldithiocarbamate zinc salt | ChemIDplus |
| (T-4)-bis(dimethylcarbamodithioato-κS,κS')zinc | Alan Wood's Pesticides |
| zinc bis(dimethyldithiocarbamate) | ChemIDplus |
| Citations |
|---|