EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](O)CC[C@@]34[H])[C@@]1(C)CC[C@@](O)(C#C)C2 |
| InChI | InChI=1S/C21H32O2/c1-4-21(23)12-11-19(2)14(13-21)5-6-15-16-7-8-18(22)20(16,3)10-9-17(15)19/h1,14-18,22-23H,5-13H2,2-3H3/t14-,15-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | FOCZFVYLRBKYGM-QKSWPAOXSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Ethynyl-5alpha-androstane-3beta,17beta-diol (CHEBI:79714) has role androgen (CHEBI:50113) |
| 3-Ethynyl-5alpha-androstane-3beta,17beta-diol (CHEBI:79714) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15199 | KEGG COMPOUND |