EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O2 |
| Net Charge | 0 |
| Average Mass | 320.517 |
| Monoisotopic Mass | 320.27153 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](O)CC[C@@]34[H])[C@@]1(C)CC[C@](O)(CC)C2 |
| InChI | InChI=1S/C21H36O2/c1-4-21(23)12-11-19(2)14(13-21)5-6-15-16-7-8-18(22)20(16,3)10-9-17(15)19/h14-18,22-23H,4-13H2,1-3H3/t14-,15-,16-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | LLYZBWQKINZAKR-UAMJIQGISA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Ethyl-5alpha-androstane-3alpha,17beta-diol (CHEBI:79713) has role androgen (CHEBI:50113) |
| 3-Ethyl-5alpha-androstane-3alpha,17beta-diol (CHEBI:79713) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15198 | KEGG COMPOUND |