EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O2 |
| Net Charge | 0 |
| Average Mass | 284.399 |
| Monoisotopic Mass | 284.17763 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC=C1[C@@]3(C)CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h8,11,14-15H,3-7,9-10H2,1-2H3/t14-,15-,18-,19-/m0/s1 |
| InChIKey | HJTUINCBGMVXOB-LNMJFAINSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Androsta-4,9(11)-diene-3,17-dione (CHEBI:79710) has role androgen (CHEBI:50113) |
| Androsta-4,9(11)-diene-3,17-dione (CHEBI:79710) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 9(11)-Dehydroandrostenedione | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15194 | KEGG COMPOUND |