EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12C[C@H](C)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C20H30O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h11-12,14-16,18,22H,4-10H2,1-3H3/t12-,14-,15-,16-,18-,19+,20-/m0/s1 |
| InChIKey | QRHBXQAFGLVWFW-JQMFHEMUSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-Hydroxy-6alpha-methylandrost-4-en-3-one (CHEBI:79701) has role androgen (CHEBI:50113) |
| 17beta-Hydroxy-6alpha-methylandrost-4-en-3-one (CHEBI:79701) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 6alpha-Methyltestosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15184 | KEGG COMPOUND |