EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O4SR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 243.260 |
| Monoisotopic Mass (excl. R groups) | 243.04395 |
| SMILES | *C1=NC(C(=O)O)C2([H])SC(C)(C)[C@H](C(=O)O)N12 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penillic acid (CHEBI:7969) is a carboxylic acid (CHEBI:33575) |
| penillic acid (CHEBI:7969) is a dicarboxylic acid (CHEBI:35692) |
| penillic acid (CHEBI:7969) is a imidazothiazole (CHEBI:48909) |
| Incoming Relation(s) |
| benzylpenillic acid (CHEBI:60219) is a penillic acid (CHEBI:7969) |
| Synonyms | Source |
|---|---|
| Penillic acid | KEGG COMPOUND |
| penillic acids | ChEBI |
| PNI | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11746 | KEGG COMPOUND |
| Citations |
|---|