EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27FO3 |
| Net Charge | 0 |
| Average Mass | 322.420 |
| Monoisotopic Mass | 322.19442 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)[C@H](F)[C@]1(C)[C@@H](O)CC[C@]12[H] |
| InChI | InChI=1S/C19H27FO3/c1-18-8-7-11(21)9-10(18)3-4-12-13-5-6-14(22)19(13,2)17(20)16(23)15(12)18/h9,12-17,22-23H,3-8H2,1-2H3/t12-,13-,14-,15+,16+,17-,18-,19-/m0/s1 |
| InChIKey | JKRMUSMTFMBPFM-HPLVRFQDSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12alpha-Fluoro-11beta,17beta-dihydroxyandrost-4-en-3-one (CHEBI:79682) has role androgen (CHEBI:50113) |
| 12alpha-Fluoro-11beta,17beta-dihydroxyandrost-4-en-3-one (CHEBI:79682) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15164 | KEGG COMPOUND |