EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O3 |
| Net Charge | 0 |
| Average Mass | 300.398 |
| Monoisotopic Mass | 300.17254 |
| SMILES | [H][C@]12CC[C@]3(C)C(=O)CC[C@@]3(O)[C@]1([H])CCC1=CC(=O)C=C[C@@]12C |
| InChI | InChI=1S/C19H24O3/c1-17-8-5-13(20)11-12(17)3-4-15-14(17)6-9-18(2)16(21)7-10-19(15,18)22/h5,8,11,14-15,22H,3-4,6-7,9-10H2,1-2H3/t14-,15+,17-,18+,19+/m0/s1 |
| InChIKey | JPSFSZXAYMJGAK-BSWVEEBUSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-Hydroxyandrosta-1,4-diene-3,17-dione (CHEBI:79668) has role androgen (CHEBI:50113) |
| 14-Hydroxyandrosta-1,4-diene-3,17-dione (CHEBI:79668) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15150 | KEGG COMPOUND |