EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO2 |
| Net Charge | 0 |
| Average Mass | 329.484 |
| Monoisotopic Mass | 329.23548 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](NC(C)=O)CC[C@@]21[H] |
| InChI | InChI=1S/C21H31NO2/c1-13(23)22-19-7-6-17-16-5-4-14-12-15(24)8-10-20(14,2)18(16)9-11-21(17,19)3/h12,16-19H,4-11H2,1-3H3,(H,22,23)/t16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | SDLZQPJEYFVSOQ-PXQJOHHUSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-Acetamidoandrost-4-en-3-one (CHEBI:79667) has role androgen (CHEBI:50113) |
| 17beta-Acetamidoandrost-4-en-3-one (CHEBI:79667) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15149 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1865-62-9 | KEGG COMPOUND |