EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25FO3 |
| Net Charge | 0 |
| Average Mass | 332.415 |
| Monoisotopic Mass | 332.17877 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1(F)[C@@H](O)C[C@]1(C)C(=O)[C@H](C)C[C@@]21[H] |
| InChI | InChI=1S/C20H25FO3/c1-11-8-15-14-5-4-12-9-13(22)6-7-19(12,3)20(14,21)16(23)10-18(15,2)17(11)24/h6-7,9,11,14-16,23H,4-5,8,10H2,1-3H3/t11-,14+,15+,16+,18+,19+,20+/m1/s1 |
| InChIKey | IZLVPOBNINIXJM-FETOPEPRSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Fluoro-11beta-hydroxy-16alpha-methylandrosta-1,4-diene-3,17-dione (CHEBI:79665) has role androgen (CHEBI:50113) |
| 9-Fluoro-11beta-hydroxy-16alpha-methylandrosta-1,4-diene-3,17-dione (CHEBI:79665) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15147 | KEGG COMPOUND |