EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O6 |
| Net Charge | 0 |
| Average Mass | 344.363 |
| Monoisotopic Mass | 344.12599 |
| SMILES | COc1ccc(C2CC(=O)c3c(cc(OC)c(OC)c3OC)O2)cc1 |
| InChI | InChI=1S/C19H20O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-8,10,14H,9H2,1-4H3 |
| InChIKey | AENXIAWIJGWYCP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polygonum aviculare (ncbitaxon:137693) | - | Article (The genus polygonum (polygonaceae): an ethnopharmacological and phytochemical perspectives-Review) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydro-2-(4-methoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one (CHEBI:79637) has functional parent flavanone (CHEBI:5070) |
| 2,3-dihydro-2-(4-methoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one (CHEBI:79637) has role plant metabolite (CHEBI:76924) |
| 2,3-dihydro-2-(4-methoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one (CHEBI:79637) is a 4'-methoxyflavanones (CHEBI:140332) |
| IUPAC Name |
|---|
| 5,6,7-trimethoxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 4',5,6,7-Tetramethoxyflavanone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00008234 | KNApSAcK |
| C15118 | KEGG COMPOUND |
| LMPK12140620 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:2569-77-9 | KEGG COMPOUND |