EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | [H][C@@]12C[C@H](C)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| InChI | InChI=1S/C21H32O2/c1-13-11-15-16(19(2)8-5-14(22)12-18(13)19)6-9-20(3)17(15)7-10-21(20,4)23/h12-13,15-17,23H,5-11H2,1-4H3/t13-,15+,16-,17-,19+,20-,21-/m0/s1 |
| InChIKey | VIOHBAKRYSSFFE-YQVBJQERSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-Hydroxy-6alpha,17-dimethylandrost-4-en-3-one (CHEBI:79627) has role androgen (CHEBI:50113) |
| 17beta-Hydroxy-6alpha,17-dimethylandrost-4-en-3-one (CHEBI:79627) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 6alpha,17alpha-Dimethyltestosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15108 | KEGG COMPOUND |