EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23FO4 |
| Net Charge | 0 |
| Average Mass | 334.387 |
| Monoisotopic Mass | 334.15804 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1(F)C(=O)C[C@]1(C)C(=O)[C@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C19H23FO4/c1-17-9-15(23)19(20)12(13(17)8-14(22)16(17)24)4-3-10-7-11(21)5-6-18(10,19)2/h7,12-14,22H,3-6,8-9H2,1-2H3/t12-,13-,14+,17-,18-,19-/m0/s1 |
| InChIKey | IASWIBHERBRGSC-MCRQTLMJSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Fluoro-16alpha-hydroxyandrost-4-ene-3,11,17-trione (CHEBI:79624) has role androgen (CHEBI:50113) |
| 9-Fluoro-16alpha-hydroxyandrost-4-ene-3,11,17-trione (CHEBI:79624) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15105 | KEGG COMPOUND |