EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O3 |
| Net Charge | 0 |
| Average Mass | 190.198 |
| Monoisotopic Mass | 190.06299 |
| SMILES | O=C1CCC(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C11H10O3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-4,9H,5-6H2,(H,13,14) |
| InChIKey | KTWAOLHYZNAOLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3,4-Tetrahydro-4-oxo-1-naphthoic acid (CHEBI:79621) is a naphthoic acid (CHEBI:25483) |
| Manual Xrefs | Databases |
|---|---|
| C15102 | KEGG COMPOUND |