EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(CO)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H30O3/c1-18-8-7-16-14(15(18)4-5-17(18)22)3-2-12-10-13(21)6-9-19(12,16)11-20/h2,13-17,20-22H,3-11H2,1H3/t13-,14-,15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | KPTQFNUKAKVGSS-ACJJDMNUSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Androst-5-ene-3beta,17beta,19-triol (CHEBI:79616) has role androgen (CHEBI:50113) |
| Androst-5-ene-3beta,17beta,19-triol (CHEBI:79616) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15097 | KEGG COMPOUND |