EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29FO3 |
| Net Charge | 0 |
| Average Mass | 348.458 |
| Monoisotopic Mass | 348.21007 |
| SMILES | [H][C@@]12CC[C@](C)(O)[C@@]1(C)CC(=O)[C@@]1(F)[C@@]2([H])C[C@H](C)C2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H29FO3/c1-12-9-16-14-6-8-20(4,25)19(14,3)11-17(24)21(16,22)18(2)7-5-13(23)10-15(12)18/h10,12,14,16,25H,5-9,11H2,1-4H3/t12-,14-,16-,18-,19-,20-,21-/m0/s1 |
| InChIKey | ROEQORMRPIEYSE-FXZCQDAKSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Fluoro-17beta-hydroxy-6alpha,17-dimethylandrost-4-ene-3,11-dione (CHEBI:79610) has role androgen (CHEBI:50113) |
| 9-Fluoro-17beta-hydroxy-6alpha,17-dimethylandrost-4-ene-3,11-dione (CHEBI:79610) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15091 | KEGG COMPOUND |