EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO4 |
| Net Charge | 0 |
| Average Mass | 273.288 |
| Monoisotopic Mass | 273.10011 |
| SMILES | COc1cccc(CCn2cc(C(=O)O)ccc2=O)c1 |
| InChI | InChI=1S/C15H15NO4/c1-20-13-4-2-3-11(9-13)7-8-16-10-12(15(18)19)5-6-14(16)17/h2-6,9-10H,7-8H2,1H3,(H,18,19) |
| InChIKey | DUZPHOXXWYWLFE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,6-Dihydro-1-(3-methoxyphenethyl)-6-oxonicotinic acid (CHEBI:79608) is a aromatic carboxylic acid (CHEBI:33859) |
| 1,6-Dihydro-1-(3-methoxyphenethyl)-6-oxonicotinic acid (CHEBI:79608) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| C15089 | KEGG COMPOUND |