EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25ClO2 |
| Net Charge | 0 |
| Average Mass | 320.860 |
| Monoisotopic Mass | 320.15431 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)[C@@H](Cl)C[C@@]21[H] |
| InChI | InChI=1S/C19H25ClO2/c1-18-7-5-12(21)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(20)17(19)22/h9,13-16H,3-8,10H2,1-2H3/t13-,14+,15+,16+,18+,19+/m1/s1 |
| InChIKey | KZGAWCNISQUJCJ-HKQXQEGQSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16beta-Chloroandrost-4-ene-3,17-dione (CHEBI:79533) has role androgen (CHEBI:50113) |
| 16beta-Chloroandrost-4-ene-3,17-dione (CHEBI:79533) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C15010 | KEGG COMPOUND |