EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N2O |
| Net Charge | 0 |
| Average Mass | 340.511 |
| Monoisotopic Mass | 340.25146 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](c3cncn3)CC[C@@]21[H] |
| InChI | InChI=1S/C22H32N2O/c1-21-9-7-15(25)11-14(21)3-4-16-17-5-6-19(20-12-23-13-24-20)22(17,2)10-8-18(16)21/h3,12-13,15-19,25H,4-11H2,1-2H3,(H,23,24)/t15-,16-,17-,18-,19+,21-,22-/m0/s1 |
| InChIKey | BBUJYEQSYYZBDG-SPHVDITISA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-(1H-Imidazol-4-yl)androst-5-en-3beta-ol (CHEBI:79521) has role androgen (CHEBI:50113) |
| 17beta-(1H-Imidazol-4-yl)androst-5-en-3beta-ol (CHEBI:79521) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C14998 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:6626-60-4 | KEGG COMPOUND |