EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O3 |
| Net Charge | 0 |
| Average Mass | 336.516 |
| Monoisotopic Mass | 336.26645 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4(C)O)[C@@]1(C)C[C@@H](CO)[C@H](O)C2 |
| InChI | InChI=1S/C21H36O3/c1-19-11-13(12-22)18(23)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h13-18,22-24H,4-12H2,1-3H3/t13-,14-,15+,16-,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | FJEQNAVGFPKKSD-KWHXHVTNSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2alpha-(Hydroxymethyl)-17-methyl-5alpha-androstane-3beta,17beta-diol (CHEBI:79501) has role androgen (CHEBI:50113) |
| 2alpha-(Hydroxymethyl)-17-methyl-5alpha-androstane-3beta,17beta-diol (CHEBI:79501) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C14977 | KEGG COMPOUND |