EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O3S |
| Net Charge | 0 |
| Average Mass | 376.562 |
| Monoisotopic Mass | 376.20722 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])[C@H](SC(=O)CC)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C22H32O3S/c1-4-19(25)26-17-12-13-11-14(23)7-9-21(13,2)16-8-10-22(3)15(20(16)17)5-6-18(22)24/h11,15-18,20,24H,4-10,12H2,1-3H3/t15-,16-,17+,18-,20-,21-,22-/m0/s1 |
| InChIKey | HONIPOFOKOETAA-MUVPWNSGSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-Hydroxy-7alpha-mercaptoandrost-4-en-3-one 7-propionate (CHEBI:79497) has role androgen (CHEBI:50113) |
| 17beta-Hydroxy-7alpha-mercaptoandrost-4-en-3-one 7-propionate (CHEBI:79497) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| S-(17beta-Hydroxy-3-oxoandrost-4-en-7alpha-yl)propanethioate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14973 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:6947-46-2 | KEGG COMPOUND |